C20H20N4O3 — CID 91530331
2-methyl-N'-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)propanediamide (PubChem CID 91530331) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 2-methyl-N'-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)propanediamide.
| Compound Name | 2-methyl-N'-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)propanediamide |
|---|---|
| PubChem CID | 91530331 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-methyl-N'-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)propanediamide |
| SMILES | CC(C(N)=O)C(=O)NC1N=C(c2ccccc2)c2ccccc2N(C)C1=O |
| InChI | InChI=1S/C20H20N4O3/c1-12(17(21)25)19(26)23-18-20(27)24(2)15-11-7-6-10-14(15)16(22-18)13-8-4-3-5-9-13/h3-12,18H,1-2H3,(H2,21,25)(H,23,26) |
| InChIKey | QICNWDJBFQARLQ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|