C25H31N3O2 — CID 22472912
2-methyl-N-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)octanamide (PubChem CID 22472912) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 2-methyl-N-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)octanamide.
| Compound Name | 2-methyl-N-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)octanamide |
|---|---|
| PubChem CID | 22472912 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 2-methyl-N-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)octanamide |
| SMILES | CCCCCCC(C)C(=O)NC1N=C(c2ccccc2)c2ccccc2N(C)C1=O |
| InChI | InChI=1S/C25H31N3O2/c1-4-5-6-8-13-18(2)24(29)27-23-25(30)28(3)21-17-12-11-16-20(21)22(26-23)19-14-9-7-10-15-19/h7,9-12,14-18,23H,4-6,8,13H2,1-3H3,(H,27,29) |
| InChIKey | RESYRSTUMPBGPI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|