C28H30N4O2 — CID 174400819
N-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-2-(3-phenylpropylamino)propanamide (PubChem CID 174400819) has the molecular formula C28H30N4O2 and a molecular weight of 454.57 g/mol. Its IUPAC name is N-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-2-(3-phenylpropylamino)propanamide.
| Compound Name | N-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-2-(3-phenylpropylamino)propanamide |
|---|---|
| PubChem CID | 174400819 |
| Molecular Formula | C28H30N4O2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | N-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-2-(3-phenylpropylamino)propanamide |
| SMILES | CC(NCCCc1ccccc1)C(=O)N[C@H]1N=C(c2ccccc2)c2ccccc2N(C)C1=O |
| InChI | InChI=1S/C28H30N4O2/c1-20(29-19-11-14-21-12-5-3-6-13-21)27(33)31-26-28(34)32(2)24-18-10-9-17-23(24)25(30-26)22-15-7-4-8-16-22/h3-10,12-13,15-18,20,26,29H,11,14,19H2,1-2H3,(H,31,33)/t20?,26-/m1/s1 |
| InChIKey | TWCYNDQSRIFLCN-NBXNUCLWSA-N |
| XLogP | 3.55 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|