C26H25N3O2 — CID 22854095
N-[(3R)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-4-phenylbutanamide (PubChem CID 22854095) has the molecular formula C26H25N3O2 and a molecular weight of 411.50 g/mol. Its IUPAC name is N-[(3R)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-4-phenylbutanamide.
| Compound Name | N-[(3R)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 22854095 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | N-[(3R)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-4-phenylbutanamide |
| SMILES | CN1C(=O)[C@H](NC(=O)CCCc2ccccc2)N=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C26H25N3O2/c1-29-22-17-9-8-16-21(22)24(20-14-6-3-7-15-20)28-25(26(29)31)27-23(30)18-10-13-19-11-4-2-5-12-19/h2-9,11-12,14-17,25H,10,13,18H2,1H3,(H,27,30)/t25-/m1/s1 |
| InChIKey | ORGDRVVUEBNSDP-RUZDIDTESA-N |
| XLogP | 3.97 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |