C25H21N3O2 — CID 11741399
(E)-N-[(3R)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-3-phenylprop-2-enamide (PubChem CID 11741399) has the molecular formula C25H21N3O2 and a molecular weight of 395.46 g/mol. Its IUPAC name is (E)-N-[(3R)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(3R)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 11741399 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | (E)-N-[(3R)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-3-phenylprop-2-enamide |
| SMILES | CN1C(=O)[C@H](NC(=O)/C=C/c2ccccc2)N=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C25H21N3O2/c1-28-21-15-9-8-14-20(21)23(19-12-6-3-7-13-19)27-24(25(28)30)26-22(29)17-16-18-10-4-2-5-11-18/h2-17,24H,1H3,(H,26,29)/b17-16+/t24-/m1/s1 |
| InChIKey | NUPMWKNZJMFJQO-GQRCBVMOSA-N |
| XLogP | 3.66 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|