C21H21ClN4O3S — CID 21024985
N-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-N'-sulfanylpentanediamide (PubChem CID 21024985) has the molecular formula C21H21ClN4O3S and a molecular weight of 444.94 g/mol. Its IUPAC name is N-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-N'-sulfanylpentanediamide.
| Compound Name | N-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-N'-sulfanylpentanediamide |
|---|---|
| PubChem CID | 21024985 |
| Molecular Formula | C21H21ClN4O3S |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | N-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-N'-sulfanylpentanediamide |
| SMILES | CN1C(=O)C(NC(=O)CCCC(=O)NS)N=C(c2ccccc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C21H21ClN4O3S/c1-26-16-11-10-14(22)12-15(16)19(13-6-3-2-4-7-13)24-20(21(26)29)23-17(27)8-5-9-18(28)25-30/h2-4,6-7,10-12,20,30H,5,8-9H2,1H3,(H,23,27)(H,25,28) |
| InChIKey | VINZZGDUQORZRZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|