C22H23ClN4O3S — CID 59713882
ethyl 3-[(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)carbamothioylamino]propanoate (PubChem CID 59713882) has the molecular formula C22H23ClN4O3S and a molecular weight of 458.97 g/mol. Its IUPAC name is ethyl 3-[(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)carbamothioylamino]propanoate.
| Compound Name | ethyl 3-[(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)carbamothioylamino]propanoate |
|---|---|
| PubChem CID | 59713882 |
| Molecular Formula | C22H23ClN4O3S |
| Molecular Weight | 458.97 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | ethyl 3-[(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)carbamothioylamino]propanoate |
| SMILES | CCOC(=O)CCNC(=S)NC1N=C(c2ccccc2)c2cc(Cl)ccc2N(C)C1=O |
| InChI | InChI=1S/C22H23ClN4O3S/c1-3-30-18(28)11-12-24-22(31)26-20-21(29)27(2)17-10-9-15(23)13-16(17)19(25-20)14-7-5-4-6-8-14/h4-10,13,20H,3,11-12H2,1-2H3,(H2,24,26,31) |
| InChIKey | MYCBJTFVTDHSDQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.97 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|