C25H21Cl3N4OS — CID 59714358
1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-[2-(2-chlorophenyl)ethyl]thiourea (PubChem CID 59714358) has the molecular formula C25H21Cl3N4OS and a molecular weight of 531.90 g/mol. Its IUPAC name is 1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-[2-(2-chlorophenyl)ethyl]thiourea.
| Compound Name | 1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-[2-(2-chlorophenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 59714358 |
| Molecular Formula | C25H21Cl3N4OS |
| Molecular Weight | 531.90 g/mol |
| Exact Mass | 530.05 |
| IUPAC Name | 1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-[2-(2-chlorophenyl)ethyl]thiourea |
| SMILES | CN1C(=O)C(NC(=S)NCCc2ccccc2Cl)N=C(c2ccccc2Cl)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C25H21Cl3N4OS/c1-32-21-11-10-16(26)14-18(21)22(17-7-3-5-9-20(17)28)30-23(24(32)33)31-25(34)29-13-12-15-6-2-4-8-19(15)27/h2-11,14,23H,12-13H2,1H3,(H2,29,31,34) |
| InChIKey | UWAXFWVPJHIKSW-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.90 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|