C20H18Cl2N4OS — CID 59714293
1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-cyclopropylthiourea (PubChem CID 59714293) has the molecular formula C20H18Cl2N4OS and a molecular weight of 433.36 g/mol. Its IUPAC name is 1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-cyclopropylthiourea.
| Compound Name | 1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-cyclopropylthiourea |
|---|---|
| PubChem CID | 59714293 |
| Molecular Formula | C20H18Cl2N4OS |
| Molecular Weight | 433.36 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-cyclopropylthiourea |
| SMILES | CN1C(=O)C(NC(=S)NC2CC2)N=C(c2ccccc2Cl)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C20H18Cl2N4OS/c1-26-16-9-6-11(21)10-14(16)17(13-4-2-3-5-15(13)22)24-18(19(26)27)25-20(28)23-12-7-8-12/h2-6,9-10,12,18H,7-8H2,1H3,(H2,23,25,28) |
| InChIKey | GMYAYVFRPBNZRQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|