C21H21Cl2N5OS — CID 59714337
N-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]piperazine-1-carbothioamide (PubChem CID 59714337) has the molecular formula C21H21Cl2N5OS and a molecular weight of 462.41 g/mol. Its IUPAC name is N-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]piperazine-1-carbothioamide.
| Compound Name | N-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 59714337 |
| Molecular Formula | C21H21Cl2N5OS |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | N-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]piperazine-1-carbothioamide |
| SMILES | CN1C(=O)C(NC(=S)N2CCNCC2)N=C(c2ccccc2Cl)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C21H21Cl2N5OS/c1-27-17-7-6-13(22)12-15(17)18(14-4-2-3-5-16(14)23)25-19(20(27)29)26-21(30)28-10-8-24-9-11-28/h2-7,12,19,24H,8-11H2,1H3,(H,26,30) |
| InChIKey | YAYSTJFWERCSPX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|