C28H27Cl2N5OS — CID 59713691
4-benzyl-N-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]piperazine-1-carbothioamide (PubChem CID 59713691) has the molecular formula C28H27Cl2N5OS and a molecular weight of 552.53 g/mol. Its IUPAC name is 4-benzyl-N-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]piperazine-1-carbothioamide.
| Compound Name | 4-benzyl-N-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 59713691 |
| Molecular Formula | C28H27Cl2N5OS |
| Molecular Weight | 552.53 g/mol |
| Exact Mass | 551.13 |
| IUPAC Name | 4-benzyl-N-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]piperazine-1-carbothioamide |
| SMILES | CN1C(=O)C(NC(=S)N2CCN(Cc3ccccc3)CC2)N=C(c2ccccc2Cl)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C28H27Cl2N5OS/c1-33-24-12-11-20(29)17-22(24)25(21-9-5-6-10-23(21)30)31-26(27(33)36)32-28(37)35-15-13-34(14-16-35)18-19-7-3-2-4-8-19/h2-12,17,26H,13-16,18H2,1H3,(H,32,37) |
| InChIKey | BPXFTDJDIOKCBE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|