C29H30ClN5OS — CID 59714024
1-(1-benzylpiperidin-4-yl)-3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)thiourea (PubChem CID 59714024) has the molecular formula C29H30ClN5OS and a molecular weight of 532.11 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)thiourea.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)thiourea |
|---|---|
| PubChem CID | 59714024 |
| Molecular Formula | C29H30ClN5OS |
| Molecular Weight | 532.11 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)thiourea |
| SMILES | CN1C(=O)C(NC(=S)NC2CCN(Cc3ccccc3)CC2)N=C(c2ccccc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C29H30ClN5OS/c1-34-25-13-12-22(30)18-24(25)26(21-10-6-3-7-11-21)32-27(28(34)36)33-29(37)31-23-14-16-35(17-15-23)19-20-8-4-2-5-9-20/h2-13,18,23,27H,14-17,19H2,1H3,(H2,31,33,37) |
| InChIKey | QAOPOHAMGZDWNB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.11 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|