C23H26ClN5OS — CID 59714077
N-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(dimethylamino)pyrrolidine-1-carbothioamide (PubChem CID 59714077) has the molecular formula C23H26ClN5OS and a molecular weight of 456.02 g/mol. Its IUPAC name is N-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(dimethylamino)pyrrolidine-1-carbothioamide.
| Compound Name | N-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(dimethylamino)pyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 59714077 |
| Molecular Formula | C23H26ClN5OS |
| Molecular Weight | 456.02 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | N-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(dimethylamino)pyrrolidine-1-carbothioamide |
| SMILES | CN1C(=O)C(NC(=S)N2CCC(N(C)C)C2)N=C(c2ccccc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C23H26ClN5OS/c1-27(2)17-11-12-29(14-17)23(31)26-21-22(30)28(3)19-10-9-16(24)13-18(19)20(25-21)15-7-5-4-6-8-15/h4-10,13,17,21H,11-12,14H2,1-3H3,(H,26,31) |
| InChIKey | LGUOLCNPHSJYMU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.02 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|