C27H24Cl3N5OS — CID 59714551
N-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-4-(3,5-dichlorophenyl)piperazine-1-carbothioamide (PubChem CID 59714551) has the molecular formula C27H24Cl3N5OS and a molecular weight of 572.95 g/mol. Its IUPAC name is N-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-4-(3,5-dichlorophenyl)piperazine-1-carbothioamide.
| Compound Name | N-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-4-(3,5-dichlorophenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 59714551 |
| Molecular Formula | C27H24Cl3N5OS |
| Molecular Weight | 572.95 g/mol |
| Exact Mass | 571.08 |
| IUPAC Name | N-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-4-(3,5-dichlorophenyl)piperazine-1-carbothioamide |
| SMILES | CN1C(=O)C(NC(=S)N2CCN(c3cc(Cl)cc(Cl)c3)CC2)N=C(c2ccccc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C27H24Cl3N5OS/c1-33-23-8-7-18(28)16-22(23)24(17-5-3-2-4-6-17)31-25(26(33)36)32-27(37)35-11-9-34(10-12-35)21-14-19(29)13-20(30)15-21/h2-8,13-16,25H,9-12H2,1H3,(H,32,37) |
| InChIKey | POKXWKBSYVXOGA-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.95 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|