C21H23ClN4OS — CID 59713934
1-butan-2-yl-3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)thiourea (PubChem CID 59713934) has the molecular formula C21H23ClN4OS and a molecular weight of 414.96 g/mol. Its IUPAC name is 1-butan-2-yl-3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)thiourea.
| Compound Name | 1-butan-2-yl-3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)thiourea |
|---|---|
| PubChem CID | 59713934 |
| Molecular Formula | C21H23ClN4OS |
| Molecular Weight | 414.96 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 1-butan-2-yl-3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)thiourea |
| SMILES | CCC(C)NC(=S)NC1N=C(c2ccccc2)c2cc(Cl)ccc2N(C)C1=O |
| InChI | InChI=1S/C21H23ClN4OS/c1-4-13(2)23-21(28)25-19-20(27)26(3)17-11-10-15(22)12-16(17)18(24-19)14-8-6-5-7-9-14/h5-13,19H,4H2,1-3H3,(H2,23,25,28) |
| InChIKey | MWGFPLAUEUAYMZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.96 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|