C21H22Cl2N4OS — CID 59713799
1-butan-2-yl-3-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]thiourea (PubChem CID 59713799) has the molecular formula C21H22Cl2N4OS and a molecular weight of 449.41 g/mol. Its IUPAC name is 1-butan-2-yl-3-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]thiourea.
| Compound Name | 1-butan-2-yl-3-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]thiourea |
|---|---|
| PubChem CID | 59713799 |
| Molecular Formula | C21H22Cl2N4OS |
| Molecular Weight | 449.41 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 1-butan-2-yl-3-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]thiourea |
| SMILES | CCC(C)NC(=S)NC1N=C(c2ccccc2Cl)c2cc(Cl)ccc2N(C)C1=O |
| InChI | InChI=1S/C21H22Cl2N4OS/c1-4-12(2)24-21(29)26-19-20(28)27(3)17-10-9-13(22)11-15(17)18(25-19)14-7-5-6-8-16(14)23/h5-12,19H,4H2,1-3H3,(H2,24,26,29) |
| InChIKey | ZPDZNWOUPYRWPW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|