C24H19Cl2FN4OS — CID 59713797
1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-[(4-fluorophenyl)methyl]thiourea (PubChem CID 59713797) has the molecular formula C24H19Cl2FN4OS and a molecular weight of 501.41 g/mol. Its IUPAC name is 1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-[(4-fluorophenyl)methyl]thiourea.
| Compound Name | 1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-[(4-fluorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 59713797 |
| Molecular Formula | C24H19Cl2FN4OS |
| Molecular Weight | 501.41 g/mol |
| Exact Mass | 500.06 |
| IUPAC Name | 1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-[(4-fluorophenyl)methyl]thiourea |
| SMILES | CN1C(=O)C(NC(=S)NCc2ccc(F)cc2)N=C(c2ccccc2Cl)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C24H19Cl2FN4OS/c1-31-20-11-8-15(25)12-18(20)21(17-4-2-3-5-19(17)26)29-22(23(31)32)30-24(33)28-13-14-6-9-16(27)10-7-14/h2-12,22H,13H2,1H3,(H2,28,30,33) |
| InChIKey | GQBUIYXNTMYKJZ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.41 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|