C24H26Cl2N4O2S — CID 59714584
1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-[(2-hydroxycyclohexyl)methyl]thiourea (PubChem CID 59714584) has the molecular formula C24H26Cl2N4O2S and a molecular weight of 505.47 g/mol. Its IUPAC name is 1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-[(2-hydroxycyclohexyl)methyl]thiourea.
| Compound Name | 1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-[(2-hydroxycyclohexyl)methyl]thiourea |
|---|---|
| PubChem CID | 59714584 |
| Molecular Formula | C24H26Cl2N4O2S |
| Molecular Weight | 505.47 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | 1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-[(2-hydroxycyclohexyl)methyl]thiourea |
| SMILES | CN1C(=O)C(NC(=S)NCC2CCCCC2O)N=C(c2ccccc2Cl)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C24H26Cl2N4O2S/c1-30-19-11-10-15(25)12-17(19)21(16-7-3-4-8-18(16)26)28-22(23(30)32)29-24(33)27-13-14-6-2-5-9-20(14)31/h3-4,7-8,10-12,14,20,22,31H,2,5-6,9,13H2,1H3,(H2,27,29,33) |
| InChIKey | KGNVBSIAVQSMQT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|