C26H24Cl2N4OS — CID 59714513
1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-(3-phenylpropyl)thiourea (PubChem CID 59714513) has the molecular formula C26H24Cl2N4OS and a molecular weight of 511.48 g/mol. Its IUPAC name is 1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-(3-phenylpropyl)thiourea.
| Compound Name | 1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-(3-phenylpropyl)thiourea |
|---|---|
| PubChem CID | 59714513 |
| Molecular Formula | C26H24Cl2N4OS |
| Molecular Weight | 511.48 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | 1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-(3-phenylpropyl)thiourea |
| SMILES | CN1C(=O)C(NC(=S)NCCCc2ccccc2)N=C(c2ccccc2Cl)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C26H24Cl2N4OS/c1-32-22-14-13-18(27)16-20(22)23(19-11-5-6-12-21(19)28)30-24(25(32)33)31-26(34)29-15-7-10-17-8-3-2-4-9-17/h2-6,8-9,11-14,16,24H,7,10,15H2,1H3,(H2,29,31,34) |
| InChIKey | XOHXRYDAAVEQIN-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.48 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|