C32H28Cl2N4OS — CID 59714259
1-benzyl-3-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-1-(2-phenylethyl)thiourea (PubChem CID 59714259) has the molecular formula C32H28Cl2N4OS and a molecular weight of 587.58 g/mol. Its IUPAC name is 1-benzyl-3-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-1-(2-phenylethyl)thiourea.
| Compound Name | 1-benzyl-3-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-1-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 59714259 |
| Molecular Formula | C32H28Cl2N4OS |
| Molecular Weight | 587.58 g/mol |
| Exact Mass | 586.14 |
| IUPAC Name | 1-benzyl-3-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-1-(2-phenylethyl)thiourea |
| SMILES | CN1C(=O)C(NC(=S)N(CCc2ccccc2)Cc2ccccc2)N=C(c2ccccc2Cl)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C32H28Cl2N4OS/c1-37-28-17-16-24(33)20-26(28)29(25-14-8-9-15-27(25)34)35-30(31(37)39)36-32(40)38(21-23-12-6-3-7-13-23)19-18-22-10-4-2-5-11-22/h2-17,20,30H,18-19,21H2,1H3,(H,36,40) |
| InChIKey | OTEUERIXJGJWOL-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.58 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|