C21H20Cl2N4O3S — CID 142255353
3-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-1-(1,3-dioxolan-2-yl)-1-methylthiourea (PubChem CID 142255353) has the molecular formula C21H20Cl2N4O3S and a molecular weight of 479.39 g/mol. Its IUPAC name is 3-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-1-(1,3-dioxolan-2-yl)-1-methylthiourea.
| Compound Name | 3-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-1-(1,3-dioxolan-2-yl)-1-methylthiourea |
|---|---|
| PubChem CID | 142255353 |
| Molecular Formula | C21H20Cl2N4O3S |
| Molecular Weight | 479.39 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | 3-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-1-(1,3-dioxolan-2-yl)-1-methylthiourea |
| SMILES | CN1C(=O)C(NC(=S)N(C)C2OCCO2)N=C(c2ccccc2Cl)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C21H20Cl2N4O3S/c1-26-16-8-7-12(22)11-14(16)17(13-5-3-4-6-15(13)23)24-18(19(26)28)25-20(31)27(2)21-29-9-10-30-21/h3-8,11,18,21H,9-10H2,1-2H3,(H,25,31) |
| InChIKey | YRNFYYNMBWNCKM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|