C24H20Cl2N4OS — CID 59714002
3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-1-(2-chlorophenyl)-1-methylthiourea (PubChem CID 59714002) has the molecular formula C24H20Cl2N4OS and a molecular weight of 483.42 g/mol. Its IUPAC name is 3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-1-(2-chlorophenyl)-1-methylthiourea.
| Compound Name | 3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-1-(2-chlorophenyl)-1-methylthiourea |
|---|---|
| PubChem CID | 59714002 |
| Molecular Formula | C24H20Cl2N4OS |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | 3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-1-(2-chlorophenyl)-1-methylthiourea |
| SMILES | CN(C(=S)NC1N=C(c2ccccc2)c2cc(Cl)ccc2N(C)C1=O)c1ccccc1Cl |
| InChI | InChI=1S/C24H20Cl2N4OS/c1-29-19-13-12-16(25)14-17(19)21(15-8-4-3-5-9-15)27-22(23(29)31)28-24(32)30(2)20-11-7-6-10-18(20)26/h3-14,22H,1-2H3,(H,28,32) |
| InChIKey | VNIFAVSYZYYHQH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|