C25H23ClN4OS — CID 59714496
3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-1-methyl-1-(3-methylphenyl)thiourea (PubChem CID 59714496) has the molecular formula C25H23ClN4OS and a molecular weight of 463.01 g/mol. Its IUPAC name is 3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-1-methyl-1-(3-methylphenyl)thiourea.
| Compound Name | 3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-1-methyl-1-(3-methylphenyl)thiourea |
|---|---|
| PubChem CID | 59714496 |
| Molecular Formula | C25H23ClN4OS |
| Molecular Weight | 463.01 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-1-methyl-1-(3-methylphenyl)thiourea |
| SMILES | Cc1cccc(N(C)C(=S)NC2N=C(c3ccccc3)c3cc(Cl)ccc3N(C)C2=O)c1 |
| InChI | InChI=1S/C25H23ClN4OS/c1-16-8-7-11-19(14-16)29(2)25(32)28-23-24(31)30(3)21-13-12-18(26)15-20(21)22(27-23)17-9-5-4-6-10-17/h4-15,23H,1-3H3,(H,28,32) |
| InChIKey | YLWKDIQRZWKCGO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.01 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|