C27H28ClN5OS — CID 142255339
1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-[2-(2,4-dimethylanilino)ethyl]thiourea (PubChem CID 142255339) has the molecular formula C27H28ClN5OS and a molecular weight of 506.08 g/mol. Its IUPAC name is 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-[2-(2,4-dimethylanilino)ethyl]thiourea.
| Compound Name | 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-[2-(2,4-dimethylanilino)ethyl]thiourea |
|---|---|
| PubChem CID | 142255339 |
| Molecular Formula | C27H28ClN5OS |
| Molecular Weight | 506.08 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-[2-(2,4-dimethylanilino)ethyl]thiourea |
| SMILES | Cc1ccc(NCCNC(=S)NC2N=C(c3ccccc3)c3cc(Cl)ccc3N(C)C2=O)c(C)c1 |
| InChI | InChI=1S/C27H28ClN5OS/c1-17-9-11-22(18(2)15-17)29-13-14-30-27(35)32-25-26(34)33(3)23-12-10-20(28)16-21(23)24(31-25)19-7-5-4-6-8-19/h4-12,15-16,25,29H,13-14H2,1-3H3,(H2,30,32,35) |
| InChIKey | ISSSQTCWBOZJAD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.08 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|