C24H28ClN5O2S — CID 59714465
1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 59714465) has the molecular formula C24H28ClN5O2S and a molecular weight of 486.04 g/mol. Its IUPAC name is 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 59714465 |
| Molecular Formula | C24H28ClN5O2S |
| Molecular Weight | 486.04 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | CN1C(=O)C(NC(=S)NCCCN2CCOCC2)N=C(c2ccccc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C24H28ClN5O2S/c1-29-20-9-8-18(25)16-19(20)21(17-6-3-2-4-7-17)27-22(23(29)31)28-24(33)26-10-5-11-30-12-14-32-15-13-30/h2-4,6-9,16,22H,5,10-15H2,1H3,(H2,26,28,33) |
| InChIKey | LXBUAXQIHIFGFC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.04 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|