C21H19ClN6OS — CID 90992923
1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(5-methyl-1H-pyrazol-3-yl)thiourea (PubChem CID 90992923) has the molecular formula C21H19ClN6OS and a molecular weight of 438.94 g/mol. Its IUPAC name is 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(5-methyl-1H-pyrazol-3-yl)thiourea.
| Compound Name | 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(5-methyl-1H-pyrazol-3-yl)thiourea |
|---|---|
| PubChem CID | 90992923 |
| Molecular Formula | C21H19ClN6OS |
| Molecular Weight | 438.94 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(5-methyl-1H-pyrazol-3-yl)thiourea |
| SMILES | Cc1cc(NC(=S)NC2N=C(c3ccccc3)c3cc(Cl)ccc3N(C)C2=O)n[nH]1 |
| InChI | InChI=1S/C21H19ClN6OS/c1-12-10-17(27-26-12)23-21(30)25-19-20(29)28(2)16-9-8-14(22)11-15(16)18(24-19)13-6-4-3-5-7-13/h3-11,19H,1-2H3,(H3,23,25,26,27,30) |
| InChIKey | INLKXBKLVBBLCF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.94 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|