C26H22ClN5OS — CID 89273005
1-(4a,8a-dihydroisoquinolin-3-yl)-3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)thiourea (PubChem CID 89273005) has the molecular formula C26H22ClN5OS and a molecular weight of 488.02 g/mol. Its IUPAC name is 1-(4a,8a-dihydroisoquinolin-3-yl)-3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)thiourea.
| Compound Name | 1-(4a,8a-dihydroisoquinolin-3-yl)-3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)thiourea |
|---|---|
| PubChem CID | 89273005 |
| Molecular Formula | C26H22ClN5OS |
| Molecular Weight | 488.02 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 1-(4a,8a-dihydroisoquinolin-3-yl)-3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)thiourea |
| SMILES | CN1C(=O)C(NC(=S)NC2=CC3C=CC=CC3C=N2)N=C(c2ccccc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C26H22ClN5OS/c1-32-21-12-11-19(27)14-20(21)23(16-7-3-2-4-8-16)30-24(25(32)33)31-26(34)29-22-13-17-9-5-6-10-18(17)15-28-22/h2-15,17-18,24H,1H3,(H2,29,31,34) |
| InChIKey | WHTWHWQYQHSMSW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 69.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.02 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|