C23H18BrClN4OS — CID 59714155
1-(2-bromophenyl)-3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)thiourea (PubChem CID 59714155) has the molecular formula C23H18BrClN4OS and a molecular weight of 513.85 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)thiourea.
| Compound Name | 1-(2-bromophenyl)-3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)thiourea |
|---|---|
| PubChem CID | 59714155 |
| Molecular Formula | C23H18BrClN4OS |
| Molecular Weight | 513.85 g/mol |
| Exact Mass | 512.01 |
| IUPAC Name | 1-(2-bromophenyl)-3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)thiourea |
| SMILES | CN1C(=O)C(NC(=S)Nc2ccccc2Br)N=C(c2ccccc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C23H18BrClN4OS/c1-29-19-12-11-15(25)13-16(19)20(14-7-3-2-4-8-14)27-21(22(29)30)28-23(31)26-18-10-6-5-9-17(18)24/h2-13,21H,1H3,(H2,26,28,31) |
| InChIKey | AIEIZFHKEIKJFN-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.85 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|