C25H24ClN5OS — CID 59714418
1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(6-propyl-2-pyridinyl)thiourea (PubChem CID 59714418) has the molecular formula C25H24ClN5OS and a molecular weight of 478.02 g/mol. Its IUPAC name is 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(6-propyl-2-pyridinyl)thiourea.
| Compound Name | 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(6-propyl-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 59714418 |
| Molecular Formula | C25H24ClN5OS |
| Molecular Weight | 478.02 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(6-propyl-2-pyridinyl)thiourea |
| SMILES | CCCc1cccc(NC(=S)NC2N=C(c3ccccc3)c3cc(Cl)ccc3N(C)C2=O)n1 |
| InChI | InChI=1S/C25H24ClN5OS/c1-3-8-18-11-7-12-21(27-18)28-25(33)30-23-24(32)31(2)20-14-13-17(26)15-19(20)22(29-23)16-9-5-4-6-10-16/h4-7,9-15,23H,3,8H2,1-2H3,(H2,27,28,30,33) |
| InChIKey | HUAFCPGRORWAOC-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.02 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|