C21H18ClN5OS2 — CID 59714549
1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(3-methyl-1,2-thiazol-5-yl)thiourea (PubChem CID 59714549) has the molecular formula C21H18ClN5OS2 and a molecular weight of 456.00 g/mol. Its IUPAC name is 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(3-methyl-1,2-thiazol-5-yl)thiourea.
| Compound Name | 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(3-methyl-1,2-thiazol-5-yl)thiourea |
|---|---|
| PubChem CID | 59714549 |
| Molecular Formula | C21H18ClN5OS2 |
| Molecular Weight | 456.00 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(3-methyl-1,2-thiazol-5-yl)thiourea |
| SMILES | Cc1cc(NC(=S)NC2N=C(c3ccccc3)c3cc(Cl)ccc3N(C)C2=O)sn1 |
| InChI | InChI=1S/C21H18ClN5OS2/c1-12-10-17(30-26-12)23-21(29)25-19-20(28)27(2)16-9-8-14(22)11-15(16)18(24-19)13-6-4-3-5-7-13/h3-11,19H,1-2H3,(H2,23,25,29) |
| InChIKey | NQUPCKKMHGIYJJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.00 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|