C23H20ClN5OS — CID 59714193
1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(6-methyl-2-pyridinyl)thiourea (PubChem CID 59714193) has the molecular formula C23H20ClN5OS and a molecular weight of 449.97 g/mol. Its IUPAC name is 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(6-methyl-2-pyridinyl)thiourea.
| Compound Name | 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(6-methyl-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 59714193 |
| Molecular Formula | C23H20ClN5OS |
| Molecular Weight | 449.97 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(6-methyl-2-pyridinyl)thiourea |
| SMILES | Cc1cccc(NC(=S)NC2N=C(c3ccccc3)c3cc(Cl)ccc3N(C)C2=O)n1 |
| InChI | InChI=1S/C23H20ClN5OS/c1-14-7-6-10-19(25-14)26-23(31)28-21-22(30)29(2)18-12-11-16(24)13-17(18)20(27-21)15-8-4-3-5-9-15/h3-13,21H,1-2H3,(H2,25,26,28,31) |
| InChIKey | MUINXQIIZZTXRH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.97 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|