C25H28ClN5OS — CID 91267476
1-[4-(1-aminoethylidene)cyclohexyl]-3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)thiourea (PubChem CID 91267476) has the molecular formula C25H28ClN5OS and a molecular weight of 482.05 g/mol. Its IUPAC name is 1-[4-(1-aminoethylidene)cyclohexyl]-3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)thiourea.
| Compound Name | 1-[4-(1-aminoethylidene)cyclohexyl]-3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)thiourea |
|---|---|
| PubChem CID | 91267476 |
| Molecular Formula | C25H28ClN5OS |
| Molecular Weight | 482.05 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 1-[4-(1-aminoethylidene)cyclohexyl]-3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)thiourea |
| SMILES | CC(N)=C1CCC(NC(=S)NC2N=C(c3ccccc3)c3cc(Cl)ccc3N(C)C2=O)CC1 |
| InChI | InChI=1S/C25H28ClN5OS/c1-15(27)16-8-11-19(12-9-16)28-25(33)30-23-24(32)31(2)21-13-10-18(26)14-20(21)22(29-23)17-6-4-3-5-7-17/h3-7,10,13-14,19,23H,8-9,11-12,27H2,1-2H3,(H2,28,30,33)/b16-15- |
| InChIKey | QEZDUXKFUWZFRL-NXVVXOECSA-N |
| XLogP | 4.12 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.05 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|