C24H27ClN4OS — CID 59714652
1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(3-methylcyclohexyl)thiourea (PubChem CID 59714652) has the molecular formula C24H27ClN4OS and a molecular weight of 455.03 g/mol. Its IUPAC name is 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(3-methylcyclohexyl)thiourea.
| Compound Name | 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(3-methylcyclohexyl)thiourea |
|---|---|
| PubChem CID | 59714652 |
| Molecular Formula | C24H27ClN4OS |
| Molecular Weight | 455.03 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(3-methylcyclohexyl)thiourea |
| SMILES | CC1CCCC(NC(=S)NC2N=C(c3ccccc3)c3cc(Cl)ccc3N(C)C2=O)C1 |
| InChI | InChI=1S/C24H27ClN4OS/c1-15-7-6-10-18(13-15)26-24(31)28-22-23(30)29(2)20-12-11-17(25)14-19(20)21(27-22)16-8-4-3-5-9-16/h3-5,8-9,11-12,14-15,18,22H,6-7,10,13H2,1-2H3,(H2,26,28,31) |
| InChIKey | HPDJVJMWIWABTQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.03 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|