C22H23ClN4O2S — CID 59714318
1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 59714318) has the molecular formula C22H23ClN4O2S and a molecular weight of 442.97 g/mol. Its IUPAC name is 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 59714318 |
| Molecular Formula | C22H23ClN4O2S |
| Molecular Weight | 442.97 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | CN1C(=O)C(NC(=S)NCC2CCCO2)N=C(c2ccccc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C22H23ClN4O2S/c1-27-18-10-9-15(23)12-17(18)19(14-6-3-2-4-7-14)25-20(21(27)28)26-22(30)24-13-16-8-5-11-29-16/h2-4,6-7,9-10,12,16,20H,5,8,11,13H2,1H3,(H2,24,26,30) |
| InChIKey | IWDPBPSWEPSSJM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.97 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|