C26H24Cl2N4O2S — CID 59714250
1-benzyl-3-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-1-(2-hydroxyethyl)thiourea (PubChem CID 59714250) has the molecular formula C26H24Cl2N4O2S and a molecular weight of 527.48 g/mol. Its IUPAC name is 1-benzyl-3-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-1-(2-hydroxyethyl)thiourea.
| Compound Name | 1-benzyl-3-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-1-(2-hydroxyethyl)thiourea |
|---|---|
| PubChem CID | 59714250 |
| Molecular Formula | C26H24Cl2N4O2S |
| Molecular Weight | 527.48 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | 1-benzyl-3-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-1-(2-hydroxyethyl)thiourea |
| SMILES | CN1C(=O)C(NC(=S)N(CCO)Cc2ccccc2)N=C(c2ccccc2Cl)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C26H24Cl2N4O2S/c1-31-22-12-11-18(27)15-20(22)23(19-9-5-6-10-21(19)28)29-24(25(31)34)30-26(35)32(13-14-33)16-17-7-3-2-4-8-17/h2-12,15,24,33H,13-14,16H2,1H3,(H,30,35) |
| InChIKey | LRUNVXVHTIFLFD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|