C23H24Cl2N4OS — CID 59713931
N-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-4-methylpiperidine-1-carbothioamide (PubChem CID 59713931) has the molecular formula C23H24Cl2N4OS and a molecular weight of 475.45 g/mol. Its IUPAC name is N-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-4-methylpiperidine-1-carbothioamide.
| Compound Name | N-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-4-methylpiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 59713931 |
| Molecular Formula | C23H24Cl2N4OS |
| Molecular Weight | 475.45 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | N-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-4-methylpiperidine-1-carbothioamide |
| SMILES | CC1CCN(C(=S)NC2N=C(c3ccccc3Cl)c3cc(Cl)ccc3N(C)C2=O)CC1 |
| InChI | InChI=1S/C23H24Cl2N4OS/c1-14-9-11-29(12-10-14)23(31)27-21-22(30)28(2)19-8-7-15(24)13-17(19)20(26-21)16-5-3-4-6-18(16)25/h3-8,13-14,21H,9-12H2,1-2H3,(H,27,31) |
| InChIKey | IIWVCQKPUIBEMR-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|