C29H28F3N5OS — CID 142254871
N-(1,7-dimethyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide (PubChem CID 142254871) has the molecular formula C29H28F3N5OS and a molecular weight of 551.64 g/mol. Its IUPAC name is N-(1,7-dimethyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide.
| Compound Name | N-(1,7-dimethyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 142254871 |
| Molecular Formula | C29H28F3N5OS |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | N-(1,7-dimethyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
| SMILES | Cc1ccc2c(c1)C(c1ccccc1)=NC(NC(=S)N1CCN(c3cccc(C(F)(F)F)c3)CC1)C(=O)N2C |
| InChI | InChI=1S/C29H28F3N5OS/c1-19-11-12-24-23(17-19)25(20-7-4-3-5-8-20)33-26(27(38)35(24)2)34-28(39)37-15-13-36(14-16-37)22-10-6-9-21(18-22)29(30,31)32/h3-12,17-18,26H,13-16H2,1-2H3,(H,34,39) |
| InChIKey | SSBWAMOJYGQZFO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|