C19H20F3N3S — CID 8615611
N-(3-methylphenyl)-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide (PubChem CID 8615611) has the molecular formula C19H20F3N3S and a molecular weight of 379.45 g/mol. Its IUPAC name is N-(3-methylphenyl)-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide.
| Compound Name | N-(3-methylphenyl)-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8615611 |
| Molecular Formula | C19H20F3N3S |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | N-(3-methylphenyl)-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
| SMILES | Cc1cccc(NC(=S)N2CCN(c3cccc(C(F)(F)F)c3)CC2)c1 |
| InChI | InChI=1S/C19H20F3N3S/c1-14-4-2-6-16(12-14)23-18(26)25-10-8-24(9-11-25)17-7-3-5-15(13-17)19(20,21)22/h2-7,12-13H,8-11H2,1H3,(H,23,26) |
| InChIKey | FHKNYRDPAVRBFO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|