C18H18F3N3OS — CID 17312667
4-(3-hydroxyphenyl)-N-[4-(trifluoromethyl)phenyl]piperazine-1-carbothioamide (PubChem CID 17312667) has the molecular formula C18H18F3N3OS and a molecular weight of 381.42 g/mol. Its IUPAC name is 4-(3-hydroxyphenyl)-N-[4-(trifluoromethyl)phenyl]piperazine-1-carbothioamide.
| Compound Name | 4-(3-hydroxyphenyl)-N-[4-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 17312667 |
| Molecular Formula | C18H18F3N3OS |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 4-(3-hydroxyphenyl)-N-[4-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
| SMILES | Oc1cccc(N2CCN(C(=S)Nc3ccc(C(F)(F)F)cc3)CC2)c1 |
| InChI | InChI=1S/C18H18F3N3OS/c19-18(20,21)13-4-6-14(7-5-13)22-17(26)24-10-8-23(9-11-24)15-2-1-3-16(25)12-15/h1-7,12,25H,8-11H2,(H,22,26) |
| InChIKey | QFDFNEXBLAFNER-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|