C17H17F3N4OS — CID 166751626
4-(6-oxo-1H-pyridin-2-yl)-N-[4-(trifluoromethyl)phenyl]piperazine-1-carbothioamide (PubChem CID 166751626) has the molecular formula C17H17F3N4OS and a molecular weight of 382.41 g/mol. Its IUPAC name is 4-(6-oxo-1H-pyridin-2-yl)-N-[4-(trifluoromethyl)phenyl]piperazine-1-carbothioamide.
| Compound Name | 4-(6-oxo-1H-pyridin-2-yl)-N-[4-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 166751626 |
| Molecular Formula | C17H17F3N4OS |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 4-(6-oxo-1H-pyridin-2-yl)-N-[4-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
| SMILES | O=c1cccc(N2CCN(C(=S)Nc3ccc(C(F)(F)F)cc3)CC2)[nH]1 |
| InChI | InChI=1S/C17H17F3N4OS/c18-17(19,20)12-4-6-13(7-5-12)21-16(26)24-10-8-23(9-11-24)14-2-1-3-15(25)22-14/h1-7H,8-11H2,(H,21,26)(H,22,25) |
| InChIKey | MINXJKMQUGBRMZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|