C29H32F4N6O3S — CID 145126828
N-cyclohexyl-4-nitro-3-(trifluoromethyl)aniline;N-(4-fluorophenyl)-4-(6-oxo-1H-pyridin-2-yl)piperazine-1-carbothioamide (PubChem CID 145126828) has the molecular formula C29H32F4N6O3S and a molecular weight of 620.67 g/mol. Its IUPAC name is N-cyclohexyl-4-nitro-3-(trifluoromethyl)aniline;N-(4-fluorophenyl)-4-(6-oxo-1H-pyridin-2-yl)piperazine-1-carbothioamide.
| Compound Name | N-cyclohexyl-4-nitro-3-(trifluoromethyl)aniline;N-(4-fluorophenyl)-4-(6-oxo-1H-pyridin-2-yl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 145126828 |
| Molecular Formula | C29H32F4N6O3S |
| Molecular Weight | 620.67 g/mol |
| Exact Mass | 620.22 |
| IUPAC Name | N-cyclohexyl-4-nitro-3-(trifluoromethyl)aniline;N-(4-fluorophenyl)-4-(6-oxo-1H-pyridin-2-yl)piperazine-1-carbothioamide |
| SMILES | O=[N+]([O-])c1ccc(NC2CCCCC2)cc1C(F)(F)F.O=c1cccc(N2CCN(C(=S)Nc3ccc(F)cc3)CC2)[nH]1 |
| InChI | InChI=1S/C16H17FN4OS.C13H15F3N2O2/c17-12-4-6-13(7-5-12)18-16(23)21-10-8-20(9-11-21)14-2-1-3-15(22)19-14;14-13(15,16)11-8-10(6-7-12(11)18(19)20)17-9-4-2-1-3-5-9/h1-7H,8-11H2,(H,18,23)(H,19,22);6-9,17H,1-5H2 |
| InChIKey | JILFBUDBSYOWFN-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.67 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|