C18H16Cl2F3N3S — CID 19654664
4-(3,4-dichlorophenyl)-N-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide (PubChem CID 19654664) has the molecular formula C18H16Cl2F3N3S and a molecular weight of 434.31 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-N-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide.
| Compound Name | 4-(3,4-dichlorophenyl)-N-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19654664 |
| Molecular Formula | C18H16Cl2F3N3S |
| Molecular Weight | 434.31 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-N-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
| SMILES | FC(F)(F)c1cccc(NC(=S)N2CCN(c3ccc(Cl)c(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C18H16Cl2F3N3S/c19-15-5-4-14(11-16(15)20)25-6-8-26(9-7-25)17(27)24-13-3-1-2-12(10-13)18(21,22)23/h1-5,10-11H,6-9H2,(H,24,27) |
| InChIKey | GXBGZBZQKIXEJT-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.31 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|