C18H17F3N4O2S — CID 1295436
N-(3-nitrophenyl)-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide (PubChem CID 1295436) has the molecular formula C18H17F3N4O2S and a molecular weight of 410.42 g/mol. Its IUPAC name is N-(3-nitrophenyl)-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide.
| Compound Name | N-(3-nitrophenyl)-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 1295436 |
| Molecular Formula | C18H17F3N4O2S |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | N-(3-nitrophenyl)-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
| SMILES | O=[N+]([O-])c1cccc(NC(=S)N2CCN(c3cccc(C(F)(F)F)c3)CC2)c1 |
| InChI | InChI=1S/C18H17F3N4O2S/c19-18(20,21)13-3-1-5-15(11-13)23-7-9-24(10-8-23)17(28)22-14-4-2-6-16(12-14)25(26)27/h1-6,11-12H,7-10H2,(H,22,28) |
| InChIKey | SDRUSLWZTNWSPT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 61.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|