C19H15Cl2N7OS — CID 59713699
1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-(1H-1,2,4-triazol-5-yl)thiourea (PubChem CID 59713699) has the molecular formula C19H15Cl2N7OS and a molecular weight of 460.35 g/mol. Its IUPAC name is 1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-(1H-1,2,4-triazol-5-yl)thiourea.
| Compound Name | 1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-(1H-1,2,4-triazol-5-yl)thiourea |
|---|---|
| PubChem CID | 59713699 |
| Molecular Formula | C19H15Cl2N7OS |
| Molecular Weight | 460.35 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | 1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-(1H-1,2,4-triazol-5-yl)thiourea |
| SMILES | CN1C(=O)C(NC(=S)Nc2ncn[nH]2)N=C(c2ccccc2Cl)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H15Cl2N7OS/c1-28-14-7-6-10(20)8-12(14)15(11-4-2-3-5-13(11)21)24-16(17(28)29)25-19(30)26-18-22-9-23-27-18/h2-9,16H,1H3,(H3,22,23,25,26,27,30) |
| InChIKey | FWPOTEBOFVXBRN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|