C26H22Cl2F3N5OS — CID 59714021
1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-[4-(dimethylamino)-3-(trifluoromethyl)phenyl]thiourea (PubChem CID 59714021) has the molecular formula C26H22Cl2F3N5OS and a molecular weight of 580.46 g/mol. Its IUPAC name is 1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-[4-(dimethylamino)-3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-[4-(dimethylamino)-3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 59714021 |
| Molecular Formula | C26H22Cl2F3N5OS |
| Molecular Weight | 580.46 g/mol |
| Exact Mass | 579.09 |
| IUPAC Name | 1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-[4-(dimethylamino)-3-(trifluoromethyl)phenyl]thiourea |
| SMILES | CN(C)c1ccc(NC(=S)NC2N=C(c3ccccc3Cl)c3cc(Cl)ccc3N(C)C2=O)cc1C(F)(F)F |
| InChI | InChI=1S/C26H22Cl2F3N5OS/c1-35(2)21-11-9-15(13-18(21)26(29,30)31)32-25(38)34-23-24(37)36(3)20-10-8-14(27)12-17(20)22(33-23)16-6-4-5-7-19(16)28/h4-13,23H,1-3H3,(H2,32,34,38) |
| InChIKey | JZQQWBDCXNTTNG-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.46 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|