C22H16BrCl2N5OS — CID 59713574
1-(5-bromo-2-pyridinyl)-3-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]thiourea (PubChem CID 59713574) has the molecular formula C22H16BrCl2N5OS and a molecular weight of 549.28 g/mol. Its IUPAC name is 1-(5-bromo-2-pyridinyl)-3-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]thiourea.
| Compound Name | 1-(5-bromo-2-pyridinyl)-3-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]thiourea |
|---|---|
| PubChem CID | 59713574 |
| Molecular Formula | C22H16BrCl2N5OS |
| Molecular Weight | 549.28 g/mol |
| Exact Mass | 546.96 |
| IUPAC Name | 1-(5-bromo-2-pyridinyl)-3-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]thiourea |
| SMILES | CN1C(=O)C(NC(=S)Nc2ccc(Br)cn2)N=C(c2ccccc2Cl)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C22H16BrCl2N5OS/c1-30-17-8-7-13(24)10-15(17)19(14-4-2-3-5-16(14)25)28-20(21(30)31)29-22(32)27-18-9-6-12(23)11-26-18/h2-11,20H,1H3,(H2,26,27,29,32) |
| InChIKey | HFNOKFLGMKLWSU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.28 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|