C29H23Cl2N5O2S — CID 59713782
1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-[3-(phenoxymethyl)-2-pyridinyl]thiourea (PubChem CID 59713782) has the molecular formula C29H23Cl2N5O2S and a molecular weight of 576.51 g/mol. Its IUPAC name is 1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-[3-(phenoxymethyl)-2-pyridinyl]thiourea.
| Compound Name | 1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-[3-(phenoxymethyl)-2-pyridinyl]thiourea |
|---|---|
| PubChem CID | 59713782 |
| Molecular Formula | C29H23Cl2N5O2S |
| Molecular Weight | 576.51 g/mol |
| Exact Mass | 575.09 |
| IUPAC Name | 1-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-[3-(phenoxymethyl)-2-pyridinyl]thiourea |
| SMILES | CN1C(=O)C(NC(=S)Nc2ncccc2COc2ccccc2)N=C(c2ccccc2Cl)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C29H23Cl2N5O2S/c1-36-24-14-13-19(30)16-22(24)25(21-11-5-6-12-23(21)31)33-27(28(36)37)35-29(39)34-26-18(8-7-15-32-26)17-38-20-9-3-2-4-10-20/h2-16,27H,17H2,1H3,(H2,32,34,35,39) |
| InChIKey | CLQIJGFSLKPHTJ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.51 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|