C25H22Cl2N4O2 — CID 54083697
N-[(3R)-7-amino-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-3-(2,4-dichlorophenyl)propanamide (PubChem CID 54083697) has the molecular formula C25H22Cl2N4O2 and a molecular weight of 481.38 g/mol. Its IUPAC name is N-[(3R)-7-amino-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-3-(2,4-dichlorophenyl)propanamide.
| Compound Name | N-[(3R)-7-amino-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-3-(2,4-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 54083697 |
| Molecular Formula | C25H22Cl2N4O2 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | N-[(3R)-7-amino-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-3-(2,4-dichlorophenyl)propanamide |
| SMILES | CN1C(=O)[C@H](NC(=O)CCc2ccc(Cl)cc2Cl)N=C(c2ccccc2)c2cc(N)ccc21 |
| InChI | InChI=1S/C25H22Cl2N4O2/c1-31-21-11-10-18(28)14-19(21)23(16-5-3-2-4-6-16)30-24(25(31)33)29-22(32)12-8-15-7-9-17(26)13-20(15)27/h2-7,9-11,13-14,24H,8,12,28H2,1H3,(H,29,32)/t24-/m1/s1 |
| InChIKey | MOXLZMDKQMUQGY-XMMPIXPASA-N |
| XLogP | 4.46 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|