C28H33N3O4 — CID 59976831
methyl (2S,3R)-5-methyl-3-[(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)carbamoyl]-2-prop-2-enylhexanoate (PubChem CID 59976831) has the molecular formula C28H33N3O4 and a molecular weight of 475.59 g/mol. Its IUPAC name is methyl (2S,3R)-5-methyl-3-[(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)carbamoyl]-2-prop-2-enylhexanoate.
| Compound Name | methyl (2S,3R)-5-methyl-3-[(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)carbamoyl]-2-prop-2-enylhexanoate |
|---|---|
| PubChem CID | 59976831 |
| Molecular Formula | C28H33N3O4 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | methyl (2S,3R)-5-methyl-3-[(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)carbamoyl]-2-prop-2-enylhexanoate |
| SMILES | C=CC[C@H](C(=O)OC)[C@@H](CC(C)C)C(=O)NC1N=C(c2ccccc2)c2ccccc2N(C)C1=O |
| InChI | InChI=1S/C28H33N3O4/c1-6-12-20(28(34)35-5)22(17-18(2)3)26(32)30-25-27(33)31(4)23-16-11-10-15-21(23)24(29-25)19-13-8-7-9-14-19/h6-11,13-16,18,20,22,25H,1,12,17H2,2-5H3,(H,30,32)/t20-,22+,25?/m0/s1 |
| InChIKey | GQZSHXLZZBXLCU-IZEQZHGBSA-N |
| XLogP | 3.97 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|