C28H37N3O4 — CID 142097490
3,5-dimethylhexanoic acid;N-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)formamide;prop-1-ene (PubChem CID 142097490) has the molecular formula C28H37N3O4 and a molecular weight of 479.62 g/mol. Its IUPAC name is 3,5-dimethylhexanoic acid;N-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)formamide;prop-1-ene.
| Compound Name | 3,5-dimethylhexanoic acid;N-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)formamide;prop-1-ene |
|---|---|
| PubChem CID | 142097490 |
| Molecular Formula | C28H37N3O4 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | 3,5-dimethylhexanoic acid;N-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)formamide;prop-1-ene |
| SMILES | C=CC.CC(C)CC(C)CC(=O)O.CN1C(=O)C(NC=O)N=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C17H15N3O2.C8H16O2.C3H6/c1-20-14-10-6-5-9-13(14)15(12-7-3-2-4-8-12)19-16(17(20)22)18-11-21;1-6(2)4-7(3)5-8(9)10;1-3-2/h2-11,16H,1H3,(H,18,21);6-7H,4-5H2,1-3H3,(H,9,10);3H,1H2,2H3 |
| InChIKey | ULPZRAFSIHQVLL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|